EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Zn.C34H32ClF3NO3.C34H32ClF3NO3 |
| Net Charge | 0 |
| Average Mass | 1255.552 |
| Monoisotopic Mass | 1252.33370 |
| SMILES | C[C@H](CCOc1cccc(CC(=O)[O-])c1)N(Cc1cccc(C(F)(F)F)c1Cl)CC(c1ccccc1)c1ccccc1.C[C@H](CCOc1cccc(CC(=O)[O-])c1)N(Cc1cccc(C(F)(F)F)c1Cl)CC(c1ccccc1)c1ccccc1.[Zn+2] |
| InChI | InChI=1S/2C34H33ClF3NO3.Zn/c2*1-24(18-19-42-29-16-8-10-25(20-29)21-32(40)41)39(22-28-15-9-17-31(33(28)35)34(36,37)38)23-30(26-11-4-2-5-12-26)27-13-6-3-7-14-27;/h2*2-17,20,24,30H,18-19,21-23H2,1H3,(H,40,41);/q;;+2/p-2/t2*24-;/m11./s1 |
| InChIKey | NKDIMXHKTSYXIU-WLHYKHABSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abequolixron zinc (CHEBI:758972) has role antineoplastic agent (CHEBI:35610) |
| abequolixron zinc (CHEBI:758972) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Abequolixron zinc | ChEMBL |
| RGX-104 Zinc | ChEMBL |