EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O3S.C29H24F4N2O3 |
| Net Charge | 0 |
| Average Mass | 698.735 |
| Monoisotopic Mass | 698.20737 |
| SMILES | Cc1ccc([SH](=O)(O)O)cc1.Oc1ccc2c3c(cnc2c1)-c1ccc(C(F)(F)F)cc1O[C@@H]3c1ccc(OCCN2CC(CF)C2)cc1 |
| InChI | InChI=1S/C29H24F4N2O3.C7H10O3S/c30-13-17-15-35(16-17)9-10-37-21-5-1-18(2-6-21)28-27-23-8-4-20(36)12-25(23)34-14-24(27)22-7-3-19(29(31,32)33)11-26(22)38-28;1-6-2-4-7(5-3-6)11(8,9)10/h1-8,11-12,14,17,28,36H,9-10,13,15-16H2;2-5,11H,1H3,(H2,8,9,10)/t28-;/m1./s1 |
| InChIKey | HVGGLUMSKULLAV-LNLSOMNWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imlunestrant tosylate (CHEBI:758962) has role antineoplastic agent (CHEBI:35610) |
| imlunestrant tosylate (CHEBI:758962) is a flavonoids (CHEBI:72544) |
| Synonyms | Source |
|---|---|
| Imlunestrant tosilate | ChEMBL |
| Imlunestrant tosylate | ChEMBL |
| LY-3484356 TOSILATE | ChEMBL |
| LY3484356 TOSILATE | ChEMBL |
| LY-3484356 TOSYLATE | ChEMBL |
| LY3484356 TOSYLATE | ChEMBL |