EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C21H27NO |
| Net Charge | 0 |
| Average Mass | 345.914 |
| Monoisotopic Mass | 345.18594 |
| SMILES | CCC(=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6-15,17H,5,16H2,1-4H3;1H/t17-;/m0./s1 |
| InChIKey | FJQXCDYVZAHXNS-LMOVPXPDSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esmethadone hydrochloride (CHEBI:758961) has role antidepressant (CHEBI:35469) |
| esmethadone hydrochloride (CHEBI:758961) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Dextromethadone hydrochloride | ChEMBL |
| D-methadone hydrochloride | ChEMBL |
| Esmethadone hydrochloride | ChEMBL |
| Methadone hydrochloride, (s)- | ChEMBL |
| REL-1017 hydrochloride | ChEMBL |