EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29FN2O |
| Net Charge | 0 |
| Average Mass | 368.496 |
| Monoisotopic Mass | 368.22639 |
| SMILES | Cc1cc(N2CCc3cc(F)ccc3C2)cc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C23H29FN2O/c1-15-10-20(11-16(2)22(15)25-21(27)13-23(3,4)5)26-9-8-17-12-19(24)7-6-18(17)14-26/h6-7,10-12H,8-9,13-14H2,1-5H3,(H,25,27) |
| InChIKey | FJNPZKZPWVVSON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azetukalner (CHEBI:758840) has role anticonvulsant (CHEBI:35623) |
| azetukalner (CHEBI:758840) has role antidepressant (CHEBI:35469) |
| azetukalner (CHEBI:758840) is a isoquinolines (CHEBI:24922) |
| INNs | Source |
|---|---|
| azetukalner | WHO MedNet |
| encukalner | WHO MedNet |
| Synonyms | Source |
|---|---|
| XEN-1101 | ChEMBL |
| XEN1101 | ChEMBL |