EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N6O3 |
| Net Charge | 0 |
| Average Mass | 492.624 |
| Monoisotopic Mass | 492.28489 |
| SMILES | COCCN(CCCCC1=CC=C2CCCN=C2N1)CC[C@H](Nc1ncnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H36N6O3/c1-36-18-17-33(15-5-4-8-21-12-11-20-7-6-14-28-25(20)31-21)16-13-24(27(34)35)32-26-22-9-2-3-10-23(22)29-19-30-26/h2-3,9-12,19,24H,4-8,13-18H2,1H3,(H,28,31)(H,34,35)(H,29,30,32)/t24-/m0/s1 |
| InChIKey | CWOFQJBATWQSHL-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bexotegrast (CHEBI:758834) has role anti-inflammatory agent (CHEBI:67079) |
| bexotegrast (CHEBI:758834) has role antifibrotic agent (CHEBI:233423) |
| bexotegrast (CHEBI:758834) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| bexotegrast | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pln 74809 | ChEMBL |
| PLN-74809 | ChEMBL |
| Citations |
|---|