EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12F2N6 |
| Net Charge | 0 |
| Average Mass | 374.354 |
| Monoisotopic Mass | 374.10915 |
| SMILES | FC(F)(c1ccc2ncccc2c1)c1nnc2ccc(-c3ccncc3)nn12 |
| InChI | InChI=1S/C20H12F2N6/c21-20(22,15-3-4-16-14(12-15)2-1-9-24-16)19-26-25-18-6-5-17(27-28(18)19)13-7-10-23-11-8-13/h1-12H |
| InChIKey | KOAWAWHSMVKCON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-38877618 (CHEBI:758832) has role antineoplastic agent (CHEBI:35610) |
| jnj-38877618 (CHEBI:758832) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Jnj-38877618 | ChEMBL |
| JNJ38877618 | ChEMBL |
| Omo 1 | ChEMBL |
| OMO-1 | ChEMBL |
| OMO1 | ChEMBL |