EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H8ClF6N5O3 |
| Net Charge | 0 |
| Average Mass | 491.735 |
| Monoisotopic Mass | 491.02199 |
| SMILES | N#Cc1cc(Cl)cc(Oc2c(C(F)(F)F)ncn(Cc3cc(C(F)(F)F)c(=O)nn3)c2=O)c1 |
| InChI | InChI=1S/C18H8ClF6N5O3/c19-9-1-8(5-26)2-11(3-9)33-13-14(18(23,24)25)27-7-30(16(13)32)6-10-4-12(17(20,21)22)15(31)29-28-10/h1-4,7H,6H2,(H,29,31) |
| InChIKey | YSFHLBYWQCLYIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulonivirine (CHEBI:758830) has role anti-HIV agent (CHEBI:64946) |
| ulonivirine (CHEBI:758830) has role antiviral agent (CHEBI:22587) |
| ulonivirine (CHEBI:758830) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| ulonivirina | WHO MedNet |
| ulonivirine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mk 8507 | ChEMBL |
| MK-8507 | ChEMBL |
| MK8507 | ChEMBL |