EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N6O2 |
| Net Charge | 0 |
| Average Mass | 322.328 |
| Monoisotopic Mass | 322.11782 |
| SMILES | O=C(NO)c1ccc(CN(c2cnccn2)c2cnccn2)cc1 |
| InChI | InChI=1S/C16H14N6O2/c23-16(21-24)13-3-1-12(2-4-13)11-22(14-9-17-5-7-19-14)15-10-18-6-8-20-15/h1-10,24H,11H2,(H,21,23) |
| InChIKey | LXHMTDHBMRZSHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ka-2507 (CHEBI:758823) has role antineoplastic agent (CHEBI:35610) |
| ka-2507 (CHEBI:758823) is a aromatic amine (CHEBI:33860) |
| ka-2507 (CHEBI:758823) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| Ka-2507 | ChEMBL |
| KA2507 | ChEMBL |