EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N6O |
| Net Charge | 0 |
| Average Mass | 400.486 |
| Monoisotopic Mass | 400.20116 |
| SMILES | N#Cc1ccc(N2CCN(Cc3ccc4c5c(c(=O)nc4c3)CCCN5)CC2)nc1 |
| InChI | InChI=1S/C23H24N6O/c24-13-17-4-6-21(26-14-17)29-10-8-28(9-11-29)15-16-3-5-18-20(12-16)27-23(30)19-2-1-7-25-22(18)19/h3-6,12,14,25H,1-2,7-11,15H2,(H,27,30) |
| InChIKey | GRPXLKXGJAGYSD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nesuparib (CHEBI:758822) has role antineoplastic agent (CHEBI:35610) |
| nesuparib (CHEBI:758822) is a piperazines (CHEBI:26144) |
| nesuparib (CHEBI:758822) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| nesuparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Jpi 547 | ChEMBL |
| JPI-547 | ChEMBL |
| JPI547 | ChEMBL |