EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N3O5 |
| Net Charge | 0 |
| Average Mass | 415.490 |
| Monoisotopic Mass | 415.21072 |
| SMILES | COc1ccc(CN2CCN(CCOC(=O)c3cccnc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C22H29N3O5/c1-27-19-7-6-18(20(28-2)21(19)29-3)16-25-11-9-24(10-12-25)13-14-30-22(26)17-5-4-8-23-15-17/h4-8,15H,9-14,16H2,1-3H3 |
| InChIKey | AGVJLPKGBKSLKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ninerafaxstat (CHEBI:758819) has role cardiovascular drug (CHEBI:35554) |
| ninerafaxstat (CHEBI:758819) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| IMB-1018972 | ChEMBL |
| Ninerafaxstat | ChEMBL |