EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12F2IN3O3S |
| Net Charge | 0 |
| Average Mass | 491.257 |
| Monoisotopic Mass | 490.96122 |
| SMILES | O=C(NOCCO)c1cc2scnc2c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H12F2IN3O3S/c17-10-5-8(19)1-2-11(10)21-14-9(16(24)22-25-4-3-23)6-12-15(13(14)18)20-7-26-12/h1-2,5-7,21,23H,3-4H2,(H,22,24) |
| InChIKey | UFZJUVFSSINETF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tunlametinib (CHEBI:758818) has role antineoplastic agent (CHEBI:35610) |
| tunlametinib (CHEBI:758818) is a benzothiazoles (CHEBI:37947) |
| Synonyms | Source |
|---|---|
| Hl 085 | ChEMBL |
| HL-085 | ChEMBL |
| HL085 | ChEMBL |
| Tunlametinib | ChEMBL |