EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O7S2 |
| Net Charge | 0 |
| Average Mass | 466.537 |
| Monoisotopic Mass | 466.08684 |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)N2C(=O)c3csc(NC(C)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C20H22N2O7S2/c1-5-29-16-8-12(6-7-15(16)28-3)14(10-31(4,26)27)22-19(24)13-9-30-18(21-11(2)23)17(13)20(22)25/h6-9,14H,5,10H2,1-4H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | PRSNGWLHNWGOKD-CQSZACIVSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-inflammatory agent Any compound that has anti-inflammatory effects. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mufemilast (CHEBI:758817) has role anti-inflammatory agent (CHEBI:67079) |
| mufemilast (CHEBI:758817) has role antipsoriatic (CHEBI:50748) |
| mufemilast (CHEBI:758817) has role dermatologic drug (CHEBI:50177) |
| mufemilast (CHEBI:758817) is a acetamides (CHEBI:22160) |
| mufemilast (CHEBI:758817) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| mufemilast | WHO MedNet |
| Synonyms | Source |
|---|---|
| HEMAY-005 | ChEMBL |
| HEMAY005 | ChEMBL |