EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758816 - gsk-3494245
| Formula | C21H23FN6O2 |
| Net Charge | 0 |
| Average Mass | 410.453 |
| Monoisotopic Mass | 410.18665 |
| SMILES | O=C(Nc1ccc(F)c(-c2ccn3c(N4CCOCC4)cnc3n2)c1)N1CCCC1 |
| InChI | InChI=1S/C21H23FN6O2/c22-17-4-3-15(24-21(29)27-6-1-2-7-27)13-16(17)18-5-8-28-19(14-23-20(28)25-18)26-9-11-30-12-10-26/h3-5,8,13-14H,1-2,6-7,9-12H2,(H,24,29) |
| InChIKey | SAJUCKZZYFFICP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-3494245 (CHEBI:758816) has role antileishmanial agent (CHEBI:70868) |
| gsk-3494245 (CHEBI:758816) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| DDD-01305143 | ChEMBL |
| DDD01305143 | ChEMBL |
| Gsk-3494245 | ChEMBL |
| GSK3494245 | ChEMBL |
| Citations |
|---|