EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36Cl2N8O4 |
| Net Charge | 0 |
| Average Mass | 691.620 |
| Monoisotopic Mass | 690.22366 |
| SMILES | COc1nc(-c2cccc(-c3cccc(-c4cnc(CNC[C@@H]5CCC(=O)N5)c(OC)n4)c3Cl)c2Cl)cnc1CNC[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C34H36Cl2N8O4/c1-47-33-27(15-37-13-19-9-11-29(45)41-19)39-17-25(43-33)23-7-3-5-21(31(23)35)22-6-4-8-24(32(22)36)26-18-40-28(34(44-26)48-2)16-38-14-20-10-12-30(46)42-20/h3-8,17-20,37-38H,9-16H2,1-2H3,(H,41,45)(H,42,46)/t19-,20-/m0/s1 |
| InChIKey | OIIOPWHTJZYKIL-PMACEKPBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evixapodlin (CHEBI:758814) has role antineoplastic agent (CHEBI:35610) |
| evixapodlin (CHEBI:758814) is a biphenyls (CHEBI:22888) |
| evixapodlin (CHEBI:758814) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| Evixapodlin | ChEMBL |
| Gs 4224 | ChEMBL |
| GS-4224 | ChEMBL |
| GS4224 | ChEMBL |
| Citations |
|---|