EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758812 - ezm-0414
| Formula | C22H29FN4O2 |
| Net Charge | 0 |
| Average Mass | 400.498 |
| Monoisotopic Mass | 400.22745 |
| SMILES | CC(=O)N1CCN([C@H]2CCC[C@@H](NC(=O)c3cc4c(F)ccc(C)c4n3)C2)CC1 |
| InChI | InChI=1S/C22H29FN4O2/c1-14-6-7-19(23)18-13-20(25-21(14)18)22(29)24-16-4-3-5-17(12-16)27-10-8-26(9-11-27)15(2)28/h6-7,13,16-17,25H,3-5,8-12H2,1-2H3,(H,24,29)/t16-,17+/m1/s1 |
| InChIKey | PGNLXEBQMQHFNK-SJORKVTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezm-0414 (CHEBI:758812) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| Ezm-0414 | ChEMBL |
| EZM0414 | ChEMBL |
| Citations |
|---|