EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26F2N10O8P2S2 |
| Net Charge | 0 |
| Average Mass | 746.612 |
| Monoisotopic Mass | 746.08198 |
| SMILES | O=[P@]1(S)OC[C@H]2O[C@@H]3[C@H](F)[C@@H]2O[P@](=O)(S)OC[C@H]2O[C@H]([C@H](F)[C@@H]2O1)n1cnc2c(ncnc21)NC/C=C/CNc1ncnc2c1ncn23 |
| InChI | InChI=1S/C24H26F2N10O8P2S2/c25-13-17-11-5-39-46(38,48)44-18-12(6-40-45(37,47)43-17)42-24(14(18)26)36-10-34-16-20(30-8-32-22(16)36)28-4-2-1-3-27-19-15-21(31-7-29-19)35(9-33-15)23(13)41-11/h1-2,7-14,17-18,23-24H,3-6H2,(H,37,47)(H,38,48)(H,27,29,31)(H,28,30,32)/b2-1+/t11-,12-,13-,14-,17-,18-,23-,24-,45-,46+/m1/s1 |
| InChIKey | YQSAUMRQALUWNS-VUCARUFASA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| e-7766 (CHEBI:758810) has role antineoplastic agent (CHEBI:35610) |
| e-7766 (CHEBI:758810) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| E 7766 | ChEMBL |
| E-7766 | ChEMBL |
| E7766 | ChEMBL |