EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C17H17FN4S.HCl |
| Net Charge | 0 |
| Average Mass | 382.892 |
| Monoisotopic Mass | 382.10304 |
| SMILES | Cc1cc2c(-c3ccccc3F)nc(N3CCNCC3)nc2s1.Cl.O |
| InChI | InChI=1S/C17H17FN4S.ClH.H2O/c1-11-10-13-15(12-4-2-3-5-14(12)18)20-17(21-16(13)23-11)22-8-6-19-7-9-22;;/h2-5,10,19H,6-9H2,1H3;1H;1H2 |
| InChIKey | SAURKKOJWIFYSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ddp-225 (CHEBI:758809) has role antispasmodic drug (CHEBI:53784) |
| ddp-225 (CHEBI:758809) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Ddp-225 | ChEMBL |
| DDP225 | ChEMBL |
| MCI-225 | ChEMBL |