EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36ClN3O5S |
| Net Charge | 0 |
| Average Mass | 562.132 |
| Monoisotopic Mass | 561.20642 |
| SMILES | [H][C@]1([C@@]2(C)Oc3c(Cl)cc(C(=O)NCc4c(SC)cc(C)nc4=O)c(C)c3O2)CC[C@H](N2CC(OC)C2)CC1 |
| InChI | InChI=1S/C28H36ClN3O5S/c1-15-10-23(38-5)21(27(34)31-15)12-30-26(33)20-11-22(29)25-24(16(20)2)36-28(3,37-25)17-6-8-18(9-7-17)32-13-19(14-32)35-4/h10-11,17-19H,6-9,12-14H2,1-5H3,(H,30,33)(H,31,34)/t17-,18-,28-/m1/s1 |
| InChIKey | CAAWBLRXQXMGHV-JAGNJQOISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tulmimetostat (CHEBI:758808) has role antineoplastic agent (CHEBI:35610) |
| tulmimetostat (CHEBI:758808) is a benzodioxoles (CHEBI:38298) |
| Synonyms | Source |
|---|---|
| Cpi 0209 | ChEMBL |
| CPI-0209 | ChEMBL |
| CPI0209 | ChEMBL |
| Tulmimetostat | ChEMBL |