EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N5O |
| Net Charge | 0 |
| Average Mass | 331.379 |
| Monoisotopic Mass | 331.14331 |
| SMILES | Cc1nnc(C(=O)Nc2cnc3nc(-c4ccccc4)cc3c2)c1C |
| InChI | InChI=1S/C19H17N5O/c1-11-12(2)23-24-17(11)19(25)21-15-8-14-9-16(22-18(14)20-10-15)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,20,22)(H,21,25)(H,23,24) |
| InChIKey | NVSHVYGIYPBTEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bezuclastinib (CHEBI:758806) has role antineoplastic agent (CHEBI:35610) |
| bezuclastinib (CHEBI:758806) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| bezuclastinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CGT-9486 | ChEMBL |
| CGT9486 | ChEMBL |
| Plx-9486 | ChEMBL |
| PLX9486 | ChEMBL |