EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H45F3N6O5 |
| Net Charge | 0 |
| Average Mass | 710.798 |
| Monoisotopic Mass | 710.34035 |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(OC)c1CN1CC[C@H](N2CCN(c3ccc(N[C@H]4CCC(=O)NC4=O)cc3F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C37H45F3N6O5/c1-22-23(2)36(49)43(3)19-26(22)24-16-31(50-4)27(32(17-24)51-5)20-44-11-10-33(37(39,40)21-44)46-14-12-45(13-15-46)30-8-6-25(18-28(30)38)41-29-7-9-34(47)42-35(29)48/h6,8,16-19,29,33,41H,7,9-15,20-21H2,1-5H3,(H,42,47,48)/t29-,33-/m0/s1 |
| InChIKey | GNRGNRCQXHMQQV-ZQAZVOLISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sendegobresib (CHEBI:758805) has role antineoplastic agent (CHEBI:35610) |
| sendegobresib (CHEBI:758805) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| sendegobresib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cft-8634 | ChEMBL |
| CFT8634 | ChEMBL |
| Citations |
|---|