EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27N3O4 |
| Net Charge | 0 |
| Average Mass | 469.541 |
| Monoisotopic Mass | 469.20016 |
| SMILES | O=C1CC[C@H](N2C(=O)c3cccc4c(Cc5ccc(CN6CCOCC6)cc5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C28H27N3O4/c32-25-11-10-24(27(33)29-25)31-23-9-8-20(21-2-1-3-22(26(21)23)28(31)34)16-18-4-6-19(7-5-18)17-30-12-14-35-15-13-30/h1-9,24H,10-17H2,(H,29,32,33)/t24-/m0/s1 |
| InChIKey | MUKCJOOKCZSQNW-DEOSSOPVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cemsidomide (CHEBI:758804) has role antineoplastic agent (CHEBI:35610) |
| cemsidomide (CHEBI:758804) is a isoindoles (CHEBI:24897) |
| INNs | Source |
|---|---|
| cemsidomida | WHO MedNet |
| cemsidomide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cft 7455 | ChEMBL |
| Cft-7455 | ChEMBL |
| CFT7455 | ChEMBL |