EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30FN5O5 |
| Net Charge | 0 |
| Average Mass | 535.576 |
| Monoisotopic Mass | 535.22310 |
| SMILES | O=C1CC[C@H](N2C(=O)c3cccc(NCc4ccc(CN5CC(N6CCOCC6)C5)cc4F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H30FN5O5/c29-21-12-17(14-32-15-19(16-32)33-8-10-39-11-9-33)4-5-18(21)13-30-22-3-1-2-20-25(22)28(38)34(27(20)37)23-6-7-24(35)31-26(23)36/h1-5,12,19,23,30H,6-11,13-16H2,(H,31,35,36)/t23-/m0/s1 |
| InChIKey | NZYDBVQXOGPDDU-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| golcadomide (CHEBI:758803) has role antineoplastic agent (CHEBI:35610) |
| golcadomide (CHEBI:758803) is a phthalimides (CHEBI:82851) |
| INNs | Source |
|---|---|
| golcadomida | WHO MedNet |
| golcadomide | WHO MedNet |
| Synonyms | Source |
|---|---|
| CC1007548 | ChEMBL |
| Cc 99282 | ChEMBL |
| CC-99282 | ChEMBL |
| CC99282 | ChEMBL |