EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22F2N6O2 |
| Net Charge | 0 |
| Average Mass | 428.443 |
| Monoisotopic Mass | 428.17723 |
| SMILES | CNC(=O)c1ccc(N2CCN(Cc3ccc4nc(C)c(=O)nc4c3F)CC2)c(F)n1 |
| InChI | InChI=1S/C21H22F2N6O2/c1-12-20(30)27-18-14(25-12)4-3-13(17(18)22)11-28-7-9-29(10-8-28)16-6-5-15(21(31)24-2)26-19(16)23/h3-6H,7-11H2,1-2H3,(H,24,31)(H,27,30) |
| InChIKey | WXRCLFFPZXJCLS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-9574 (CHEBI:758800) has role antineoplastic agent (CHEBI:35610) |
| azd-9574 (CHEBI:758800) is a piperazines (CHEBI:26144) |
| azd-9574 (CHEBI:758800) is a pyridines (CHEBI:26421) |
| Synonyms | Source |
|---|---|
| Azd-9574 | ChEMBL |
| AZD9574 | ChEMBL |
| Citations |
|---|