EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36N4O3 |
| Net Charge | 0 |
| Average Mass | 392.544 |
| Monoisotopic Mass | 392.27874 |
| SMILES | [H][C@]12CCCC[C@]1([H])N(C1CCN(C3(C)CCN(C(=O)OCC)CC3)CC1)C(=O)N2 |
| InChI | InChI=1S/C21H36N4O3/c1-3-28-20(27)23-14-10-21(2,11-15-23)24-12-8-16(9-13-24)25-18-7-5-4-6-17(18)22-19(25)26/h16-18H,3-15H2,1-2H3,(H,22,26)/t17-,18-/m0/s1 |
| InChIKey | IVJDEIANCSDDAO-ROUUACIJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-6088 (CHEBI:758798) is a carboxylic acid (CHEBI:33575) |
| azd-6088 (CHEBI:758798) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Azd 6088 | ChEMBL |
| Azd-6088 | ChEMBL |
| AZD6088 | ChEMBL |