EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N6O2 |
| Net Charge | 0 |
| Average Mass | 406.490 |
| Monoisotopic Mass | 406.21172 |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(C(=O)NC)nc4)CC3)cc2nc1=O |
| InChI | InChI=1S/C22H26N6O2/c1-3-16-11-19-20(26-21(16)29)10-15(12-24-19)14-27-6-8-28(9-7-27)17-4-5-18(25-13-17)22(30)23-2/h4-5,10-13H,3,6-9,14H2,1-2H3,(H,23,30)(H,26,29) |
| InChIKey | WQAVGRAETZEADU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saruparib (CHEBI:758797) has role antineoplastic agent (CHEBI:35610) |
| saruparib (CHEBI:758797) is a piperazines (CHEBI:26144) |
| saruparib (CHEBI:758797) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| saruparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd 5305 | ChEMBL |
| Azd-5305 | ChEMBL |
| AZD5305 | ChEMBL |
| Citations |
|---|