EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29FN3O9P |
| Net Charge | 0 |
| Average Mass | 529.458 |
| Monoisotopic Mass | 529.16254 |
| SMILES | Cc1cn([C@H]2O[C@@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@H](O)[C@H]2F)c(=O)nc1=O |
| InChI | InChI=1S/C22H29FN3O9P/c1-12(2)33-21(29)14(4)25-36(31,35-15-8-6-5-7-9-15)32-11-16-18(27)17(23)20(34-16)26-10-13(3)19(28)24-22(26)30/h5-10,12,14,16-18,20,27H,11H2,1-4H3,(H,25,31)(H,24,28,30)/t14-,16-,17+,18-,20-,36-/m0/s1 |
| InChIKey | FTMNZJASLMPPNW-MHFVGYLCSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosclevudine alafenamide (CHEBI:758791) has role anti-HBV agent (CHEBI:64951) |
| fosclevudine alafenamide (CHEBI:758791) has role antiviral agent (CHEBI:22587) |
| fosclevudine alafenamide (CHEBI:758791) is a α-amino acid ester (CHEBI:46874) |
| INNs | Source |
|---|---|
| fosclevudina alafenamida | WHO MedNet |
| fosclevudine alafenamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| AT-2173 | ChEMBL |
| ATI-2173 | ChEMBL |