EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758790 - fosgonimeton sodium
| Formula | Na.C27H44N4O8P |
| Net Charge | 0 |
| Average Mass | 606.633 |
| Monoisotopic Mass | 606.27945 |
| SMILES | CCCCCC(=O)N[C@@H](Cc1ccc(OP(=O)([O-])O)cc1)C(=O)N[C@H](C(=O)NCCCCCC(N)=O)[C@@H](C)CC.[Na+] |
| InChI | InChI=1S/C27H45N4O8P.Na/c1-4-6-8-12-24(33)30-22(18-20-13-15-21(16-14-20)39-40(36,37)38)26(34)31-25(19(3)5-2)27(35)29-17-10-7-9-11-23(28)32;/h13-16,19,22,25H,4-12,17-18H2,1-3H3,(H2,28,32)(H,29,35)(H,30,33)(H,31,34)(H2,36,37,38);/q;+1/p-1/t19-,22-,25-;/m0./s1 |
| InChIKey | FKDVTTURUVVCAT-HEGDDJOISA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosgonimeton sodium (CHEBI:758790) has role antiparkinson drug (CHEBI:48407) |
| fosgonimeton sodium (CHEBI:758790) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| ATH1017 | ChEMBL |
| ATH-1017 sodium | ChEMBL |
| Fosgonimeton sodium | ChEMBL |
| NDX1017 | ChEMBL |
| NDX-1017 sodium | ChEMBL |