EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N3O3 |
| Net Charge | 0 |
| Average Mass | 325.368 |
| Monoisotopic Mass | 325.14264 |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)Oc2cccnc2)CC1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(20-15-5-2-1-3-6-15)14-8-11-21(12-9-14)18(23)24-16-7-4-10-19-13-16/h1-7,10,13-14H,8-9,11-12H2,(H,20,22) |
| InChIKey | PLCMZPFTMOAGOE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asp-8477 (CHEBI:758789) is a carboxylic acid (CHEBI:33575) |
| asp-8477 (CHEBI:758789) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Asp 8477 | ChEMBL |
| Asp-8477 | ChEMBL |
| ASP8477 | ChEMBL |