EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N7O2 |
| Net Charge | 0 |
| Average Mass | 431.500 |
| Monoisotopic Mass | 431.20697 |
| SMILES | Cc1nc(-c2cnc(NC(C)C)n(C)c2=O)ccc1Oc1ccnc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C23H25N7O2/c1-14(2)27-23-25-12-18(22(31)30(23)5)19-6-7-21(15(3)28-19)32-17-8-9-24-20(10-17)16-11-26-29(4)13-16/h6-14H,1-5H3,(H,25,27) |
| InChIKey | TVGAHWWPABTBCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vimseltinib (CHEBI:758781) has role antineoplastic agent (CHEBI:35610) |
| vimseltinib (CHEBI:758781) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| DCC-3014 | ChEMBL |
| DP-6865 | ChEMBL |
| Vimseltinib | ChEMBL |
| Citations |
|---|