EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22F2N10O9P2S2 |
| Net Charge | 0 |
| Average Mass | 710.535 |
| Monoisotopic Mass | 710.04559 |
| SMILES | [H][C@@]1(F)[C@H]2CO[P@@](=O)(S)O[C@@]3([H])[C@H](F)[C@H](n4cnc5c(N)ncnc54)O[C@]3([H])CO[P@@](=O)(S)O[C@H]1[C@H](n1cnc3c(=O)nc(N)nc31)O2 |
| InChI | InChI=1S/C20H22F2N10O9P2S2/c21-8-6-1-36-42(34,44)40-12-7(39-18(9(12)22)31-4-27-10-14(23)25-3-26-15(10)31)2-37-43(35,45)41-13(8)19(38-6)32-5-28-11-16(32)29-20(24)30-17(11)33/h3-9,12-13,18-19H,1-2H2,(H,34,44)(H,35,45)(H2,23,25,26)(H3,24,29,30,33)/t6-,7-,8-,9+,12-,13-,18-,19-,42-,43-/m1/s1 |
| InChIKey | YSUIQYOGTINQIN-CLMXYZJCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulevostinag (CHEBI:758779) has role antineoplastic agent (CHEBI:35610) |
| ulevostinag (CHEBI:758779) is a purine nucleoside (CHEBI:26394) |
| Synonym | Source |
|---|---|
| Ulevostinag | ChEMBL |