EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N7O |
| Net Charge | 0 |
| Average Mass | 365.441 |
| Monoisotopic Mass | 365.19641 |
| SMILES | Nc1ncc(-c2cnn(C3CCNCC3)c2)cc1-c1nnc(CC2CC2)o1 |
| InChI | InChI=1S/C19H23N7O/c20-18-16(19-25-24-17(27-19)7-12-1-2-12)8-13(9-22-18)14-10-23-26(11-14)15-3-5-21-6-4-15/h8-12,15,21H,1-7H2,(H2,20,22) |
| InChIKey | JYVSYFGHYFXYBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| slc-391 (CHEBI:758775) has role antineoplastic agent (CHEBI:35610) |
| slc-391 (CHEBI:758775) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| SLC-0211 | ChEMBL |
| SLC0211 | ChEMBL |
| Slc 391 | ChEMBL |
| Slc-391 | ChEMBL |
| SLC391 | ChEMBL |