EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13F2NO |
| Net Charge | 0 |
| Average Mass | 213.227 |
| Monoisotopic Mass | 213.09652 |
| SMILES | CO[C@]1(c2cccc(F)c2F)CCNC1 |
| InChI | InChI=1S/C11H13F2NO/c1-15-11(5-6-14-7-11)8-3-2-4-9(12)10(8)13/h2-4,14H,5-7H2,1H3/t11-/m1/s1 |
| InChIKey | LJNFYMMXCXGFCP-LLVKDONJSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirepemat (CHEBI:758773) has role antiparkinson drug (CHEBI:48407) |
| pirepemat (CHEBI:758773) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| IRL-752 | ChEMBL |
| IRL752 | ChEMBL |
| Pirepemat | ChEMBL |