EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24ClFN4O3 |
| Net Charge | 0 |
| Average Mass | 458.921 |
| Monoisotopic Mass | 458.15210 |
| SMILES | CC(C)c1cnc(-c2cc(Cl)ccc2F)cc1Nc1ccncc1C(=O)NC(CO)CO |
| InChI | InChI=1S/C23H24ClFN4O3/c1-13(2)17-10-27-21(16-7-14(24)3-4-19(16)25)8-22(17)29-20-5-6-26-9-18(20)23(32)28-15(11-30)12-31/h3-10,13,15,30-31H,11-12H2,1-2H3,(H,28,32)(H,26,27,29) |
| InChIKey | IPBLCOKXDQHSQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-06952229 (CHEBI:758772) is a aromatic carboxylic acid (CHEBI:33859) |
| pf-06952229 (CHEBI:758772) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Pf 06952229 | ChEMBL |
| Pf-06952229 | ChEMBL |
| PF06952229 | ChEMBL |
| Citations |
|---|