EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O3 |
| Net Charge | 0 |
| Average Mass | 375.428 |
| Monoisotopic Mass | 375.15829 |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)cc(C)c(=O)n2Cc1ccccn1 |
| InChI | InChI=1S/C22H21N3O3/c1-13-9-16-10-18(21-14(2)24-28-15(21)3)20(27-4)11-19(16)25(22(13)26)12-17-7-5-6-8-23-17/h5-11H,12H2,1-4H3 |
| InChIKey | YVGWSVHZXWFLIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odm-207 (CHEBI:758770) has role antineoplastic agent (CHEBI:35610) |
| odm-207 (CHEBI:758770) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Bet-in-4 | ChEMBL |
| Odm 207 | ChEMBL |
| Odm-207 | ChEMBL |
| ODM207 | ChEMBL |