EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:758769 - nyx-2925
| Formula | C14H23N3O4 |
| Net Charge | 0 |
| Average Mass | 297.355 |
| Monoisotopic Mass | 297.16886 |
| SMILES | CC(C)C(=O)N1CCC[C@]12CN([C@H](C(N)=O)[C@@H](C)O)C2=O |
| InChI | InChI=1S/C14H23N3O4/c1-8(2)12(20)17-6-4-5-14(17)7-16(13(14)21)10(9(3)18)11(15)19/h8-10,18H,4-7H2,1-3H3,(H2,15,19)/t9-,10+,14-/m1/s1 |
| InChIKey | NFXPEHLDVKVVKA-ISTVAULSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nyx-2925 (CHEBI:758769) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Nyx-2925 | ChEMBL |
| Risevistinel, (4r)- | ChEMBL |