EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N4O5 |
| Net Charge | 0 |
| Average Mass | 480.565 |
| Monoisotopic Mass | 480.23727 |
| SMILES | Cc1cccc(C)c1CNc1cc(C(=O)NCCOC(=O)CCCC(=O)O)cn2c(C)c(C)nc12 |
| InChI | InChI=1S/C26H32N4O5/c1-16-7-5-8-17(2)21(16)14-28-22-13-20(15-30-19(4)18(3)29-25(22)30)26(34)27-11-12-35-24(33)10-6-9-23(31)32/h5,7-8,13,15,28H,6,9-12,14H2,1-4H3,(H,27,34)(H,31,32) |
| InChIKey | GPHPBXRKAJSSIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linaprazan glurate (CHEBI:758767) is a aromatic carboxylic acid (CHEBI:33859) |
| linaprazan glurate (CHEBI:758767) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INNs | Source |
|---|---|
| glurate de linaprazan | WHO MedNet |
| glurato de linaprazan | WHO MedNet |
| linaprazan glurate | WHO MedNet |