EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758762 - ezurpimtrostat
| Formula | C25H31ClN4 |
| Net Charge | 0 |
| Average Mass | 423.004 |
| Monoisotopic Mass | 422.22372 |
| SMILES | CC(C)(C)NC1CCN(c2cc(NCc3ccc(Cl)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C25H31ClN4/c1-25(2,3)29-20-12-14-30(15-13-20)23-16-24(28-22-7-5-4-6-21(22)23)27-17-18-8-10-19(26)11-9-18/h4-11,16,20,29H,12-15,17H2,1-3H3,(H,27,28) |
| InChIKey | QVXSJSXAVQJXOV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ezurpimtrostat (CHEBI:758762) has role antineoplastic agent (CHEBI:35610) |
| ezurpimtrostat (CHEBI:758762) has role antiviral agent (CHEBI:22587) |
| ezurpimtrostat (CHEBI:758762) is a aminoquinoline (CHEBI:36709) |
| Synonyms | Source |
|---|---|
| Ezurpimtrostat | ChEMBL |
| Gns 561 | ChEMBL |
| GNS-561 | ChEMBL |
| GNS561 | ChEMBL |
| Citations |
|---|