EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O2S |
| Net Charge | 0 |
| Average Mass | 425.518 |
| Monoisotopic Mass | 425.16339 |
| SMILES | CNC(=O)CC1=Cc2nn(Cc3ncc(C)c(OC)c3C)c3nc(N)nc(c23)SC1 |
| InChI | InChI=1S/C20H23N7O2S/c1-10-7-23-14(11(2)17(10)29-4)8-27-18-16-13(26-27)5-12(6-15(28)22-3)9-30-19(16)25-20(21)24-18/h5,7H,6,8-9H2,1-4H3,(H,22,28)(H2,21,24,25) |
| InChIKey | GRBFSGXSMHPNMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ds-2248 (CHEBI:758760) has role antineoplastic agent (CHEBI:35610) |
| ds-2248 (CHEBI:758760) is a pyrazolopyrimidine (CHEBI:38669) |
| Synonym | Source |
|---|---|
| Ds-2248 | ChEMBL |