EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8D3NO |
| Net Charge | 0 |
| Average Mass | 188.244 |
| Monoisotopic Mass | 188.10289 |
| SMILES | [2H]C([2H])([2H])c1ccc(=O)n(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3/i1D3 |
| InChIKey | ISWRGOKTTBVCFA-FIBGUPNXSA-N |
| Roles Classification |
|---|
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deupirfenidone (CHEBI:758759) has role anti-inflammatory agent (CHEBI:67079) |
| deupirfenidone (CHEBI:758759) has role antifibrotic agent (CHEBI:233423) |
| deupirfenidone (CHEBI:758759) is a pyridone (CHEBI:38183) |
| INNs | Source |
|---|---|
| deupirfenidona | WHO MedNet |
| deupirfenidone | WHO MedNet |
| Synonyms | Source |
|---|---|
| LYT-100 | ChEMBL |
| SD-560 | ChEMBL |