EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N2O9 |
| Net Charge | 0 |
| Average Mass | 528.558 |
| Monoisotopic Mass | 528.21078 |
| SMILES | [H][C@]1(O[C@H]2C[C@](O)(CCO)Cc3c(O)c4c(c(O)c32)C(=N)c2c(OC)cccc2C4=O)C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H32N2O9/c1-11-23(31)14(28)8-17(37-11)38-16-10-27(35,6-7-30)9-13-19(16)26(34)20-21(25(13)33)24(32)12-4-3-5-15(36-2)18(12)22(20)29/h3-5,11,14,16-17,23,29-31,33-35H,6-10,28H2,1-2H3/t11-,14-,16-,17-,23+,27-/m0/s1 |
| InChIKey | GNCWGPLZJLZZPI-KUIJCEFOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camsirubicin (CHEBI:758756) has role antineoplastic agent (CHEBI:35610) |
| camsirubicin (CHEBI:758756) is a anthracenes (CHEBI:46955) |
| Synonyms | Source |
|---|---|
| 5-imino-13-deoxydoxorubicin | ChEMBL |
| Camsirubicin | ChEMBL |
| Gpx-150 | ChEMBL |
| GPX150 | ChEMBL |