EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25Cl2N3O3 |
| Net Charge | 0 |
| Average Mass | 450.366 |
| Monoisotopic Mass | 449.12730 |
| SMILES | O=C1COc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C22H25Cl2N3O3/c23-17-4-3-5-19(22(17)24)27-11-9-26(10-12-27)8-1-2-13-29-16-6-7-20-18(14-16)25-21(28)15-30-20/h3-7,14H,1-2,8-13,15H2,(H,25,28) |
| InChIKey | PMKMNTBZJOXTJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brilaroxazine (CHEBI:758755) has role antipsychotic agent (CHEBI:35476) |
| brilaroxazine (CHEBI:758755) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| Brilaroxazine | ChEMBL |
| Rp5063 | ChEMBL |
| RP-5063 | ChEMBL |