EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N7O |
| Net Charge | 0 |
| Average Mass | 349.398 |
| Monoisotopic Mass | 349.16511 |
| SMILES | CCN(Cc1nc2c(N)nc3cc(-c4ccnn4)ccc3c2n1)C(C)=O |
| InChI | InChI=1S/C18H19N7O/c1-3-25(10(2)26)9-15-22-16-12-5-4-11(13-6-7-20-24-13)8-14(12)21-18(19)17(16)23-15/h4-8H,3,9H2,1-2H3,(H2,19,21)(H,20,24)(H,22,23) |
| InChIKey | UHNRLQRZRNKOKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986299 (CHEBI:758753) has role antineoplastic agent (CHEBI:35610) |
| bms-986299 (CHEBI:758753) is a imidazoquinoline (CHEBI:38776) |
| Synonym | Source |
|---|---|
| Bms-986299 | ChEMBL |
| Citations |
|---|