EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32F3N7O2 |
| Net Charge | 0 |
| Average Mass | 567.616 |
| Monoisotopic Mass | 567.25696 |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(CC(F)(F)F)c4ccccc34)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H32F3N7O2/c1-6-27(40)34-22-15-23(26(41-5)16-25(22)38(4)14-13-37(2)3)36-28-33-12-11-21(35-28)20-17-39(18-29(30,31)32)24-10-8-7-9-19(20)24/h6-12,15-17H,1,13-14,18H2,2-5H3,(H,34,40)(H,33,35,36) |
| InChIKey | USOCZVZOXKTJTI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| befotertinib (CHEBI:758750) has role antineoplastic agent (CHEBI:35610) |
| befotertinib (CHEBI:758750) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Befotertinib | ChEMBL |
| D 0316 | ChEMBL |
| D-0316 | ChEMBL |
| D0316 | ChEMBL |