EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24FN3O4S |
| Net Charge | 0 |
| Average Mass | 385.461 |
| Monoisotopic Mass | 385.14716 |
| SMILES | CC(C)CCN[C@@H]1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H24FN3O4S/c1-10(2)5-6-19-12-4-3-11-7-14(22)17(16(18)13(11)8-12)21-9-15(23)20-26(21,24)25/h7,10,12,19,22H,3-6,8-9H2,1-2H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | DVFCRTGTEXUFIN-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osunprotafib (CHEBI:758747) has role antineoplastic agent (CHEBI:35610) |
| osunprotafib (CHEBI:758747) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| osunprotafib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Abbv cls 484 | ChEMBL |
| Abbv-cls-484 | ChEMBL |
| Citations |
|---|