EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24Cl2N4O4S |
| Net Charge | 0 |
| Average Mass | 535.453 |
| Monoisotopic Mass | 534.08953 |
| SMILES | CC(C)(c1ccc(OCc2ccnc(NS(C)(=O)=O)n2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C24H24Cl2N4O4S/c1-24(2,18-12-16(14-27)22(21(26)13-18)33-11-9-25)17-4-6-20(7-5-17)34-15-19-8-10-28-23(29-19)30-35(3,31)32/h4-8,10,12-13H,9,11,15H2,1-3H3,(H,28,29,30) |
| InChIKey | GVCZSODXLFBYSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| masofaniten (CHEBI:758689) has role antineoplastic agent (CHEBI:35610) |
| masofaniten (CHEBI:758689) is a diarylmethane (CHEBI:51614) |
| INNs | Source |
|---|---|
| masofaniten | WHO MedNet |
| masofanitene | WHO MedNet |
| Synonyms | Source |
|---|---|
| EPI-7386 | ChEMBL |
| EPI7386 | ChEMBL |