EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30F2N6O |
| Net Charge | 0 |
| Average Mass | 480.563 |
| Monoisotopic Mass | 480.24492 |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc(C5CCN(C)CC5)cn4)ncc3F)cc21 |
| InChI | InChI=1S/C26H30F2N6O/c1-16(2)34-10-11-35-25-20(27)12-19(13-22(25)34)24-21(28)15-30-26(32-24)31-23-5-4-18(14-29-23)17-6-8-33(3)9-7-17/h4-5,12-17H,6-11H2,1-3H3,(H,29,30,31,32) |
| InChIKey | YZSCPLGKKMSBMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inixaciclib (CHEBI:758685) has role antineoplastic agent (CHEBI:35610) |
| inixaciclib (CHEBI:758685) is a benzoxazine (CHEBI:46969) |
| INN | Source |
|---|---|
| inixaciclib | WHO MedNet |