EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27FN8 |
| Net Charge | 0 |
| Average Mass | 446.534 |
| Monoisotopic Mass | 446.23427 |
| SMILES | CC(C)c1c2cc(-c3nc(Nc4ccc(N5CCNCC5)cn4)ncc3F)ccc2nn1C |
| InChI | InChI=1S/C24H27FN8/c1-15(2)23-18-12-16(4-6-20(18)31-32(23)3)22-19(25)14-28-24(30-22)29-21-7-5-17(13-27-21)33-10-8-26-9-11-33/h4-7,12-15,26H,8-11H2,1-3H3,(H,27,28,29,30) |
| InChIKey | LLFOBMRPWNABCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| culmerciclib (CHEBI:758677) has role antineoplastic agent (CHEBI:35610) |
| culmerciclib (CHEBI:758677) is a piperazines (CHEBI:26144) |
| culmerciclib (CHEBI:758677) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| culmerciclib | WHO MedNet |
| Citations |
|---|