EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F2N7O3 |
| Net Charge | 0 |
| Average Mass | 421.408 |
| Monoisotopic Mass | 421.16739 |
| SMILES | COCCOc1cc(F)c(N2CCN(c3nc(=O)c4nnn(C)c4n3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H21F2N7O3/c1-25-16-14(23-24-25)17(28)22-18(21-16)27-5-3-26(4-6-27)15-12(19)9-11(10-13(15)20)30-8-7-29-2/h9-10H,3-8H2,1-2H3,(H,21,22,28) |
| InChIKey | ALDDPEMJJONRDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| basroparib (CHEBI:758675) has role antineoplastic agent (CHEBI:35610) |
| basroparib (CHEBI:758675) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| basroparib | WHO MedNet |