EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32FN7O2 |
| Net Charge | 0 |
| Average Mass | 529.620 |
| Monoisotopic Mass | 529.26015 |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3cnc(C)nc3)nn2-c2ccccc2)[C@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C29H32FN7O2/c1-19-27(22-15-31-20(2)32-16-22)35-37(24-10-5-4-6-11-24)28(19)34-29(38)33-26-18-36(12-13-39-3)17-25(26)21-8-7-9-23(30)14-21/h4-11,14-16,25-26H,12-13,17-18H2,1-3H3,(H2,33,34,38)/t25-,26+/m0/s1 |
| InChIKey | BGKSBHPSVMJTFL-IZZNHLLZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anizatrectinib (CHEBI:758672) has role antineoplastic agent (CHEBI:35610) |
| anizatrectinib (CHEBI:758672) is a pyrazoles (CHEBI:26410) |
| anizatrectinib (CHEBI:758672) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| anizatrectinib | WHO MedNet |