EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N4O5S |
| Net Charge | 0 |
| Average Mass | 354.388 |
| Monoisotopic Mass | 354.09979 |
| SMILES | [H][C@@]1([C@H](CC)OC(C)=O)C[C@@H](O)[C@H](n2c(=O)sc3cnc(N)nc32)O1 |
| InChI | InChI=1S/C14H18N4O5S/c1-3-8(22-6(2)19)9-4-7(20)12(23-9)18-11-10(24-14(18)21)5-16-13(15)17-11/h5,7-9,12,20H,3-4H2,1-2H3,(H2,15,16,17)/t7-,8+,9+,12-/m1/s1 |
| InChIKey | OJEUDXXMKNXHST-JDVQERKKSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ruzotolimod (CHEBI:758666) has role anti-HBV agent (CHEBI:64951) |
| ruzotolimod (CHEBI:758666) is a pyrimidines (CHEBI:39447) |
| INN | Source |
|---|---|
| ruzotolimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| Rg-7854 | ChEMBL |
| Rg7854 | ChEMBL |
| Ro7020531 | ChEMBL |
| RO-7020531 | ChEMBL |